C19H21N2O+ — CID 123669177
4-[2-(3,5-dimethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 123669177) has the molecular formula C19H21N2O+ and a molecular weight of 293.39 g/mol. Its IUPAC name is 4-[2-(3,5-dimethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(3,5-dimethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 123669177 |
| Molecular Formula | C19H21N2O+ |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-[2-(3,5-dimethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | Cc1ccc2oc(C=Cc3ccc(N(C)C)cc3)[n+](C)c2c1 |
| InChI | InChI=1S/C19H21N2O/c1-14-5-11-18-17(13-14)21(4)19(22-18)12-8-15-6-9-16(10-7-15)20(2)3/h5-13H,1-4H3/q+1 |
| InChIKey | LSXHSINOJJZEAJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|