C22H25IN2S — CID 131738684
4-[(E)-2-[4-(2,5-dimethylphenyl)-3-methyl-1,3-thiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide (PubChem CID 131738684) has the molecular formula C22H25IN2S and a molecular weight of 476.43 g/mol. Its IUPAC name is 4-[(E)-2-[4-(2,5-dimethylphenyl)-3-methyl-1,3-thiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide.
| Compound Name | 4-[(E)-2-[4-(2,5-dimethylphenyl)-3-methyl-1,3-thiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide |
|---|---|
| PubChem CID | 131738684 |
| Molecular Formula | C22H25IN2S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 4-[(E)-2-[4-(2,5-dimethylphenyl)-3-methyl-1,3-thiazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide |
| SMILES | Cc1ccc(C)c(-c2csc(/C=C/c3ccc(N(C)C)cc3)[n+]2C)c1.[I-] |
| InChI | InChI=1S/C22H25N2S.HI/c1-16-6-7-17(2)20(14-16)21-15-25-22(24(21)5)13-10-18-8-11-19(12-9-18)23(3)4;/h6-15H,1-5H3;1H/q+1;/p-1 |
| InChIKey | RMYUDPOOCHNHRZ-UHFFFAOYSA-M |
| XLogP | 2.10 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|