C23H25N2O7S+ — CID 59956146
[2-[(E,3Z)-3-(3-ethyl-5-methoxy-1,3-benzoxazol-2-ylidene)-2-methylprop-1-enyl]-5-methoxy-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid (PubChem CID 59956146) has the molecular formula C23H25N2O7S+ and a molecular weight of 473.53 g/mol. Its IUPAC name is [2-[(E,3Z)-3-(3-ethyl-5-methoxy-1,3-benzoxazol-2-ylidene)-2-methylprop-1-enyl]-5-methoxy-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid.
| Compound Name | [2-[(E,3Z)-3-(3-ethyl-5-methoxy-1,3-benzoxazol-2-ylidene)-2-methylprop-1-enyl]-5-methoxy-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 59956146 |
| Molecular Formula | C23H25N2O7S+ |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [2-[(E,3Z)-3-(3-ethyl-5-methoxy-1,3-benzoxazol-2-ylidene)-2-methylprop-1-enyl]-5-methoxy-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid |
| SMILES | CCN1/C(=C/C(C)=C/c2oc3ccc(OC)cc3[n+]2CS(=O)(=O)O)Oc2ccc(OC)cc21 |
| InChI | InChI=1S/C23H24N2O7S/c1-5-24-18-12-16(29-3)6-8-20(18)31-22(24)10-15(2)11-23-25(14-33(26,27)28)19-13-17(30-4)7-9-21(19)32-23/h6-13H,5,14H2,1-4H3/p+1 |
| InChIKey | GJBPNKOKXYBGQG-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|