C18H18ClN2O+ — CID 793039
N-[(E)-2-(5-chloro-3-ethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N-methylaniline (PubChem CID 793039) has the molecular formula C18H18ClN2O+ and a molecular weight of 313.81 g/mol. Its IUPAC name is N-[(E)-2-(5-chloro-3-ethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N-methylaniline.
| Compound Name | N-[(E)-2-(5-chloro-3-ethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 793039 |
| Molecular Formula | C18H18ClN2O+ |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[(E)-2-(5-chloro-3-ethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N-methylaniline |
| SMILES | CC[n+]1c(/C=C/N(C)c2ccccc2)oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H18ClN2O/c1-3-21-16-13-14(19)9-10-17(16)22-18(21)11-12-20(2)15-7-5-4-6-8-15/h4-13H,3H2,1-2H3/q+1 |
| InChIKey | MNDNSIUYIXBUEM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|