C20H22Cl2N3+ — CID 1381935
N-[2-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)ethenyl]-N-methylaniline (PubChem CID 1381935) has the molecular formula C20H22Cl2N3+ and a molecular weight of 375.32 g/mol. Its IUPAC name is N-[2-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)ethenyl]-N-methylaniline.
| Compound Name | N-[2-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 1381935 |
| Molecular Formula | C20H22Cl2N3+ |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-[2-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)ethenyl]-N-methylaniline |
| SMILES | CCn1c(C=CN(C)c2ccccc2)[n+](CC)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C20H22Cl2N3/c1-4-24-18-13-16(21)17(22)14-19(18)25(5-2)20(24)11-12-23(3)15-9-7-6-8-10-15/h6-14H,4-5H2,1-3H3/q+1 |
| InChIKey | JPDANWNFKJVSKB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|