C18H27Cl2N2+ — CID 21206570
5,6-dichloro-1-ethyl-2-methyl-3-octylbenzimidazol-3-ium (PubChem CID 21206570) has the molecular formula C18H27Cl2N2+ and a molecular weight of 342.33 g/mol. Its IUPAC name is 5,6-dichloro-1-ethyl-2-methyl-3-octylbenzimidazol-3-ium.
| Compound Name | 5,6-dichloro-1-ethyl-2-methyl-3-octylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 21206570 |
| Molecular Formula | C18H27Cl2N2+ |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 5,6-dichloro-1-ethyl-2-methyl-3-octylbenzimidazol-3-ium |
| SMILES | CCCCCCCC[n+]1c(C)n(CC)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C18H27Cl2N2/c1-4-6-7-8-9-10-11-22-14(3)21(5-2)17-12-15(19)16(20)13-18(17)22/h12-13H,4-11H2,1-3H3/q+1 |
| InChIKey | RNGAFAMXOJKHAJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|