C34H43Cl4N4O4+ — CID 25131025
7-[2-[(Z)-3-[1-(5-carboxypentyl)-5,6-dichloro-3-ethylbenzimidazol-1-ium-2-yl]prop-2-enyl]-5,6-dichloro-3-ethyl-2H-benzimidazol-1-yl]heptanoic acid (PubChem CID 25131025) has the molecular formula C34H43Cl4N4O4+ and a molecular weight of 713.55 g/mol. Its IUPAC name is 7-[2-[(Z)-3-[1-(5-carboxypentyl)-5,6-dichloro-3-ethylbenzimidazol-1-ium-2-yl]prop-2-enyl]-5,6-dichloro-3-ethyl-2H-benzimidazol-1-yl]heptanoic acid.
| Compound Name | 7-[2-[(Z)-3-[1-(5-carboxypentyl)-5,6-dichloro-3-ethylbenzimidazol-1-ium-2-yl]prop-2-enyl]-5,6-dichloro-3-ethyl-2H-benzimidazol-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 25131025 |
| Molecular Formula | C34H43Cl4N4O4+ |
| Molecular Weight | 713.55 g/mol |
| Exact Mass | 711.20 |
| IUPAC Name | 7-[2-[(Z)-3-[1-(5-carboxypentyl)-5,6-dichloro-3-ethylbenzimidazol-1-ium-2-yl]prop-2-enyl]-5,6-dichloro-3-ethyl-2H-benzimidazol-1-yl]heptanoic acid |
| SMILES | CCN1c2cc(Cl)c(Cl)cc2N(CCCCCCC(=O)O)C1C/C=C\c1n(CC)c2cc(Cl)c(Cl)cc2[n+]1CCCCCC(=O)O |
| InChI | InChI=1S/C34H42Cl4N4O4/c1-3-39-27-19-23(35)25(37)21-29(27)41(17-10-6-5-8-15-33(43)44)31(39)13-12-14-32-40(4-2)28-20-24(36)26(38)22-30(28)42(32)18-11-7-9-16-34(45)46/h12,14,19-22,31H,3-11,13,15-18H2,1-2H3,(H-,43,44,45,46)/p+1/b14-12- |
| InChIKey | CJVKXXGPWVUMSV-OWBHPGMISA-O |
| XLogP | 9.32 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.55 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|