C36H47Cl4N6O3+ — CID 101141015
2-amino-2-[6-[5,6-dichloro-2-[3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-3-ethylbenzimidazol-1-ium-1-yl]hexanoylamino]heptanoic acid (PubChem CID 101141015) has the molecular formula C36H47Cl4N6O3+ and a molecular weight of 753.62 g/mol. Its IUPAC name is 2-amino-2-[6-[5,6-dichloro-2-[3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-3-ethylbenzimidazol-1-ium-1-yl]hexanoylamino]heptanoic acid.
| Compound Name | 2-amino-2-[6-[5,6-dichloro-2-[3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-3-ethylbenzimidazol-1-ium-1-yl]hexanoylamino]heptanoic acid |
|---|---|
| PubChem CID | 101141015 |
| Molecular Formula | C36H47Cl4N6O3+ |
| Molecular Weight | 753.62 g/mol |
| Exact Mass | 751.25 |
| IUPAC Name | 2-amino-2-[6-[5,6-dichloro-2-[3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-3-ethylbenzimidazol-1-ium-1-yl]hexanoylamino]heptanoic acid |
| SMILES | CCCCCC(N)(NC(=O)CCCCC[n+]1c(C=CC=C2N(CC)c3cc(Cl)c(Cl)cc3N2CC)n(CC)c2cc(Cl)c(Cl)cc21)C(=O)O |
| InChI | InChI=1S/C36H46Cl4N6O3/c1-5-9-12-18-36(41,35(48)49)42-32(47)15-11-10-13-19-46-31-23-27(40)26(39)22-30(31)45(8-4)34(46)17-14-16-33-43(6-2)28-20-24(37)25(38)21-29(28)44(33)7-3/h14,16-17,20-23H,5-13,15,18-19,41H2,1-4H3,(H-,42,47,48,49)/p+1 |
| InChIKey | HFYNJWFWBFEXAO-UHFFFAOYSA-O |
| XLogP | 8.78 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.62 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|