C16H21ClNO4S+ — CID 20580468
5-chloro-2-(2-ethylbut-1-enyl)-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-3-ium (PubChem CID 20580468) has the molecular formula C16H21ClNO4S+ and a molecular weight of 358.87 g/mol. Its IUPAC name is 5-chloro-2-(2-ethylbut-1-enyl)-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-3-ium.
| Compound Name | 5-chloro-2-(2-ethylbut-1-enyl)-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 20580468 |
| Molecular Formula | C16H21ClNO4S+ |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 5-chloro-2-(2-ethylbut-1-enyl)-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-3-ium |
| SMILES | CCC(=Cc1oc2ccc(Cl)cc2[n+]1CCCSOOO)CC |
| InChI | InChI=1S/C16H20ClNO4S/c1-3-12(4-2)10-16-18(8-5-9-23-22-21-19)14-11-13(17)6-7-15(14)20-16/h6-7,10-11H,3-5,8-9H2,1-2H3/p+1 |
| InChIKey | AHCJJGWDKAHMAG-UHFFFAOYSA-O |
| XLogP | 5.04 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|