C25H26ClN2O6S2+ — CID 59920617
3-[2-[2-[(E)-[5-chloro-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid (PubChem CID 59920617) has the molecular formula C25H26ClN2O6S2+ and a molecular weight of 550.08 g/mol. Its IUPAC name is 3-[2-[2-[(E)-[5-chloro-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid.
| Compound Name | 3-[2-[2-[(E)-[5-chloro-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
|---|---|
| PubChem CID | 59920617 |
| Molecular Formula | C25H26ClN2O6S2+ |
| Molecular Weight | 550.08 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 3-[2-[2-[(E)-[5-chloro-3-[3-(trioxidanylsulfanyl)propyl]-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
| SMILES | CCC(=Cc1sc2ccccc2[n+]1CCC(=O)O)/C=C1/Oc2ccc(Cl)cc2N1CCCSOOO |
| InChI | InChI=1S/C25H25ClN2O6S2/c1-2-17(15-24-28(12-10-25(29)30)19-6-3-4-7-22(19)36-24)14-23-27(11-5-13-35-34-33-31)20-16-18(26)8-9-21(20)32-23/h3-4,6-9,14-16H,2,5,10-13H2,1H3,(H-,29,30,31)/p+1 |
| InChIKey | SAVYETCGYBPCKM-UHFFFAOYSA-O |
| XLogP | 6.31 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.08 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|