C18H18NO3S+ — CID 68879317
[3-[(3-methoxyphenyl)methyl]-2-methyl-1,3-benzothiazol-3-ium-5-yl] acetate (PubChem CID 68879317) has the molecular formula C18H18NO3S+ and a molecular weight of 328.41 g/mol. Its IUPAC name is [3-[(3-methoxyphenyl)methyl]-2-methyl-1,3-benzothiazol-3-ium-5-yl] acetate.
| Compound Name | [3-[(3-methoxyphenyl)methyl]-2-methyl-1,3-benzothiazol-3-ium-5-yl] acetate |
|---|---|
| PubChem CID | 68879317 |
| Molecular Formula | C18H18NO3S+ |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [3-[(3-methoxyphenyl)methyl]-2-methyl-1,3-benzothiazol-3-ium-5-yl] acetate |
| SMILES | COc1cccc(C[n+]2c(C)sc3ccc(OC(C)=O)cc32)c1 |
| InChI | InChI=1S/C18H18NO3S/c1-12-19(11-14-5-4-6-15(9-14)21-3)17-10-16(22-13(2)20)7-8-18(17)23-12/h4-10H,11H2,1-3H3/q+1 |
| InChIKey | WMXLJAVKOYVISK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|