About [3-(3-iodopropyl)phenyl] acetate
[3-(3-iodopropyl)phenyl] acetate (PubChem CID 68985317) has the molecular formula C11H13IO2
and a molecular weight of 304.13 g/mol. Its IUPAC name is [3-(3-iodopropyl)phenyl] acetate.
Molecular Properties
| Compound Name | [3-(3-iodopropyl)phenyl] acetate |
| PubChem CID | 68985317 |
| Molecular Formula | C11H13IO2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | [3-(3-iodopropyl)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(CCCI)c1 |
| InChI | InChI=1S/C11H13IO2/c1-9(13)14-11-6-2-4-10(8-11)5-3-7-12/h2,4,6,8H,3,5,7H2,1H3 |
| InChIKey | MJEBPSJWSGPNHW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-iodopropyl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-iodopropyl)phenyl] acetate?
The IUPAC name of [3-(3-iodopropyl)phenyl] acetate (CID 68985317) is [3-(3-iodopropyl)phenyl] acetate.
What is the SMILES notation for [3-(3-iodopropyl)phenyl] acetate?
The canonical SMILES for [3-(3-iodopropyl)phenyl] acetate is CC(=O)Oc1cccc(CCCI)c1.
What is the InChIKey of [3-(3-iodopropyl)phenyl] acetate?
The InChIKey is MJEBPSJWSGPNHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13IO2/c1-9(13)14-11-6-2-4-10(8-11)5-3-7-12/h2,4,6,8H,3,5,7H2,1H3.
What are the key properties of [3-(3-iodopropyl)phenyl] acetate?
[3-(3-iodopropyl)phenyl] acetate has a molecular weight of 304.13 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-iodopropyl)phenyl] acetate is sourced from PubChem (CID 68985317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).