C15H13F2IO — CID 25223173
1,2-difluoro-4-[3-(3-iodopropyl)phenoxy]benzene (PubChem CID 25223173) has the molecular formula C15H13F2IO and a molecular weight of 374.17 g/mol. Its IUPAC name is 1,2-difluoro-4-[3-(3-iodopropyl)phenoxy]benzene.
| Compound Name | 1,2-difluoro-4-[3-(3-iodopropyl)phenoxy]benzene |
|---|---|
| PubChem CID | 25223173 |
| Molecular Formula | C15H13F2IO |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 1,2-difluoro-4-[3-(3-iodopropyl)phenoxy]benzene |
| SMILES | Fc1ccc(Oc2cccc(CCCI)c2)cc1F |
| InChI | InChI=1S/C15H13F2IO/c16-14-7-6-13(10-15(14)17)19-12-5-1-3-11(9-12)4-2-8-18/h1,3,5-7,9-10H,2,4,8H2 |
| InChIKey | BGBZHKFAUGBAEJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|