C18H21NO7 — CID 55466367
diethyl 2-[(5-methoxy-3-methyl-1-benzofuran-2-carbonyl)amino]propanedioate (PubChem CID 55466367) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is diethyl 2-[(5-methoxy-3-methyl-1-benzofuran-2-carbonyl)amino]propanedioate.
| Compound Name | diethyl 2-[(5-methoxy-3-methyl-1-benzofuran-2-carbonyl)amino]propanedioate |
|---|---|
| PubChem CID | 55466367 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | diethyl 2-[(5-methoxy-3-methyl-1-benzofuran-2-carbonyl)amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1oc2ccc(OC)cc2c1C)C(=O)OCC |
| InChI | InChI=1S/C18H21NO7/c1-5-24-17(21)14(18(22)25-6-2)19-16(20)15-10(3)12-9-11(23-4)7-8-13(12)26-15/h7-9,14H,5-6H2,1-4H3,(H,19,20) |
| InChIKey | XRFYIFZVUIYTQZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|