C19H24N2O5 — CID 51193858
ethyl 4-[(5-methoxy-3-methyl-1-benzofuran-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 51193858) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl 4-[(5-methoxy-3-methyl-1-benzofuran-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(5-methoxy-3-methyl-1-benzofuran-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 51193858 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | ethyl 4-[(5-methoxy-3-methyl-1-benzofuran-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2oc3ccc(OC)cc3c2C)CC1 |
| InChI | InChI=1S/C19H24N2O5/c1-4-25-19(23)21-9-7-13(8-10-21)20-18(22)17-12(2)15-11-14(24-3)5-6-16(15)26-17/h5-6,11,13H,4,7-10H2,1-3H3,(H,20,22) |
| InChIKey | OLESQSMPZUWGPU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |