C20H24N4O3 — CID 97315987
5-methoxy-3-methyl-N-[(6R)-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1-benzofuran-2-carboxamide (PubChem CID 97315987) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 5-methoxy-3-methyl-N-[(6R)-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-methoxy-3-methyl-N-[(6R)-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 97315987 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 5-methoxy-3-methyl-N-[(6R)-3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)N[C@@H]3CCc4nnc(C(C)C)n4C3)c(C)c2c1 |
| InChI | InChI=1S/C20H24N4O3/c1-11(2)19-23-22-17-8-5-13(10-24(17)19)21-20(25)18-12(3)15-9-14(26-4)6-7-16(15)27-18/h6-7,9,11,13H,5,8,10H2,1-4H3,(H,21,25)/t13-/m1/s1 |
| InChIKey | PBKJKGHQCSVGEP-CYBMUJFWSA-N |
| XLogP | 3.21 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |