C19H25N3O4 — CID 113209618
ethyl 4-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]piperidine-1-carboxylate (PubChem CID 113209618) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is ethyl 4-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113209618 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | ethyl 4-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)Cc2c[nH]c3ccc(OC)cc23)CC1 |
| InChI | InChI=1S/C19H25N3O4/c1-3-26-19(24)22-8-6-14(7-9-22)21-18(23)10-13-12-20-17-5-4-15(25-2)11-16(13)17/h4-5,11-12,14,20H,3,6-10H2,1-2H3,(H,21,23) |
| InChIKey | SIQLRSCICHPLQS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |