C33H33N3O5 — CID 20618948
1-acetyl-2-[[(2Z)-3-ethyl-2-[(2E)-2-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]butylidene]-1,3-benzoxazol-5-yl]amino]cyclopropane-1-carboxylate (PubChem CID 20618948) has the molecular formula C33H33N3O5 and a molecular weight of 551.64 g/mol. Its IUPAC name is 1-acetyl-2-[[(2Z)-3-ethyl-2-[(2E)-2-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]butylidene]-1,3-benzoxazol-5-yl]amino]cyclopropane-1-carboxylate.
| Compound Name | 1-acetyl-2-[[(2Z)-3-ethyl-2-[(2E)-2-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]butylidene]-1,3-benzoxazol-5-yl]amino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 20618948 |
| Molecular Formula | C33H33N3O5 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 1-acetyl-2-[[(2Z)-3-ethyl-2-[(2E)-2-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]butylidene]-1,3-benzoxazol-5-yl]amino]cyclopropane-1-carboxylate |
| SMILES | CCC(/C=C1\Oc2ccc(NC3CC3(C(C)=O)C(=O)[O-])cc2N1CC)=C\c1oc2ccc3ccccc3c2[n+]1CC |
| InChI | InChI=1S/C33H33N3O5/c1-5-21(17-30-36(7-3)31-24-11-9-8-10-22(24)12-14-27(31)41-30)16-29-35(6-2)25-18-23(13-15-26(25)40-29)34-28-19-33(28,20(4)37)32(38)39/h8-18,28,34H,5-7,19H2,1-4H3 |
| InChIKey | XQEUDOBTVKQJIY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|