C25H27N3O5S+2 — CID 59039953
[2-[2-[(E)-2-[(Z)-(3-ethyl-5-methyl-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]-1,3-benzoxazol-3-ium-3-yl]acetyl]-methylsulfanyloxy-oxoazanium (PubChem CID 59039953) has the molecular formula C25H27N3O5S+2 and a molecular weight of 481.57 g/mol. Its IUPAC name is [2-[2-[(E)-2-[(Z)-(3-ethyl-5-methyl-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]-1,3-benzoxazol-3-ium-3-yl]acetyl]-methylsulfanyloxy-oxoazanium.
| Compound Name | [2-[2-[(E)-2-[(Z)-(3-ethyl-5-methyl-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]-1,3-benzoxazol-3-ium-3-yl]acetyl]-methylsulfanyloxy-oxoazanium |
|---|---|
| PubChem CID | 59039953 |
| Molecular Formula | C25H27N3O5S+2 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [2-[2-[(E)-2-[(Z)-(3-ethyl-5-methyl-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]-1,3-benzoxazol-3-ium-3-yl]acetyl]-methylsulfanyloxy-oxoazanium |
| SMILES | CCC(/C=C1\Oc2ccc(C)cc2N1CC)=C\c1oc2ccccc2[n+]1CC(=O)[N+](=O)OSC |
| InChI | InChI=1S/C25H27N3O5S/c1-5-18(14-24-26(6-2)20-13-17(3)11-12-22(20)32-24)15-25-27(16-23(29)28(30)33-34-4)19-9-7-8-10-21(19)31-25/h7-15H,5-6,16H2,1-4H3/q+2 |
| InChIKey | XGNJWEWPSQXJRB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|