C19H17N2S2+ — CID 6041777
N-[(E)-2-(3-ethyl-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl)ethenyl]aniline (PubChem CID 6041777) has the molecular formula C19H17N2S2+ and a molecular weight of 337.49 g/mol. Its IUPAC name is N-[(E)-2-(3-ethyl-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl)ethenyl]aniline.
| Compound Name | N-[(E)-2-(3-ethyl-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 6041777 |
| Molecular Formula | C19H17N2S2+ |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-[(E)-2-(3-ethyl-[1]benzothiolo[2,3-d][1,3]thiazol-3-ium-2-yl)ethenyl]aniline |
| SMILES | CC[n+]1c(/C=C/Nc2ccccc2)sc2c3ccccc3sc21 |
| InChI | InChI=1S/C19H16N2S2/c1-2-21-17(12-13-20-14-8-4-3-5-9-14)23-18-15-10-6-7-11-16(15)22-19(18)21/h3-13H,2H2,1H3/p+1 |
| InChIKey | YBMXDVLMYJJNAO-UHFFFAOYSA-O |
| XLogP | 5.51 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|