C23H25BrN2O2S — CID 86585226
4-[2-(4-anilinobuta-1,3-dienyl)-1,3-benzothiazol-3-ium-3-yl]-2-ethylbutanoic acid bromide (PubChem CID 86585226) has the molecular formula C23H25BrN2O2S and a molecular weight of 473.44 g/mol. Its IUPAC name is 4-[2-(4-anilinobuta-1,3-dienyl)-1,3-benzothiazol-3-ium-3-yl]-2-ethylbutanoic acid bromide.
| Compound Name | 4-[2-(4-anilinobuta-1,3-dienyl)-1,3-benzothiazol-3-ium-3-yl]-2-ethylbutanoic acid bromide |
|---|---|
| PubChem CID | 86585226 |
| Molecular Formula | C23H25BrN2O2S |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 4-[2-(4-anilinobuta-1,3-dienyl)-1,3-benzothiazol-3-ium-3-yl]-2-ethylbutanoic acid bromide |
| SMILES | CCC(CC[n+]1c(C=CC=CNc2ccccc2)sc2ccccc21)C(=O)O.[Br-] |
| InChI | InChI=1S/C23H24N2O2S.BrH/c1-2-18(23(26)27)15-17-25-20-12-6-7-13-21(20)28-22(25)14-8-9-16-24-19-10-4-3-5-11-19;/h3-14,16,18H,2,15,17H2,1H3,(H,26,27);1H |
| InChIKey | AEDIFNXKAGERKC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|