C34H43Cl2N4O5+ — CID 158450958
3-[5-chloro-3-ethyl-2-[3-(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]propyl-triethylazanium perchlorate (PubChem CID 158450958) has the molecular formula C34H43Cl2N4O5+ and a molecular weight of 658.65 g/mol. Its IUPAC name is 3-[5-chloro-3-ethyl-2-[3-(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]propyl-triethylazanium perchlorate.
| Compound Name | 3-[5-chloro-3-ethyl-2-[3-(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]propyl-triethylazanium perchlorate |
|---|---|
| PubChem CID | 158450958 |
| Molecular Formula | C34H43Cl2N4O5+ |
| Molecular Weight | 658.65 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | 3-[5-chloro-3-ethyl-2-[3-(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)prop-2-enylidene]benzimidazol-1-yl]propyl-triethylazanium perchlorate |
| SMILES | CCN1C(=CC=Cc2oc3ccc4ccccc4c3[n+]2CC)N(CCC[N+](CC)(CC)CC)c2ccc(Cl)cc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C34H43ClN4O.ClHO4/c1-6-36-30-25-27(35)20-21-29(30)38(23-14-24-39(8-3,9-4)10-5)32(36)17-13-18-33-37(7-2)34-28-16-12-11-15-26(28)19-22-31(34)40-33;2-1(3,4)5/h11-13,15-22,25H,6-10,14,23-24H2,1-5H3;(H,2,3,4,5)/q+2;/p-1 |
| InChIKey | HDYYXPFGKAKTQJ-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 115.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.65 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|