C14H13NO3 — CID 46201506
[2-[(E)-2-phenylethenyl]-1,3-oxazol-5-yl]methyl acetate (PubChem CID 46201506) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is [2-[(E)-2-phenylethenyl]-1,3-oxazol-5-yl]methyl acetate.
| Compound Name | [2-[(E)-2-phenylethenyl]-1,3-oxazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 46201506 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | [2-[(E)-2-phenylethenyl]-1,3-oxazol-5-yl]methyl acetate |
| SMILES | CC(=O)OCc1cnc(/C=C/c2ccccc2)o1 |
| InChI | InChI=1S/C14H13NO3/c1-11(16)17-10-13-9-15-14(18-13)8-7-12-5-3-2-4-6-12/h2-9H,10H2,1H3/b8-7+ |
| InChIKey | DCZFAZJUKYLUIB-BQYQJAHWSA-N |
| XLogP | 2.91 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |