C15H15NO5S — CID 11141772
ethyl (E)-3-[5-(benzenesulfonylmethyl)-1,3-oxazol-2-yl]prop-2-enoate (PubChem CID 11141772) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is ethyl (E)-3-[5-(benzenesulfonylmethyl)-1,3-oxazol-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[5-(benzenesulfonylmethyl)-1,3-oxazol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11141772 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | ethyl (E)-3-[5-(benzenesulfonylmethyl)-1,3-oxazol-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ncc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C15H15NO5S/c1-2-20-15(17)9-8-14-16-10-12(21-14)11-22(18,19)13-6-4-3-5-7-13/h3-10H,2,11H2,1H3/b9-8+ |
| InChIKey | CUKDBXFPMQKQOD-CMDGGOBGSA-N |
| XLogP | 2.22 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|