2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid

C17H11NO4 — CID 134122364

IUPAC2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid
SMILESO=C(O)c1ccccc1C(=O)c1ncc(-c2ccccc2)o1
InChIInChI=1S/C17H11NO4/c19-15(12-8-4-5-9-13(12)17(20)21)16-18-10-14(22-16)11-6-2-1-3-7-11/h1-10H,(H,20,21)
InChIKeySAJJKYXRRVESDF-UHFFFAOYSA-N
MW293.28 g/mol
LogP3.27
Rot. Bonds4

About 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid

2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid (PubChem CID 134122364) has the molecular formula C17H11NO4 and a molecular weight of 293.28 g/mol. Its IUPAC name is 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid.

Molecular Properties

Compound Name2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid
PubChem CID134122364
Molecular FormulaC17H11NO4
Molecular Weight293.28 g/mol
Exact Mass293.07
IUPAC Name2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid
SMILESO=C(O)c1ccccc1C(=O)c1ncc(-c2ccccc2)o1
InChIInChI=1S/C17H11NO4/c19-15(12-8-4-5-9-13(12)17(20)21)16-18-10-14(22-16)11-6-2-1-3-7-11/h1-10H,(H,20,21)
InChIKeySAJJKYXRRVESDF-UHFFFAOYSA-N
XLogP3.27
TPSA80.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.28
LogP ≤ 53.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid?
The IUPAC name of 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid (CID 134122364) is 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid.
What is the SMILES notation for 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid?
The canonical SMILES for 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid is O=C(O)c1ccccc1C(=O)c1ncc(-c2ccccc2)o1.
What is the InChIKey of 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid?
The InChIKey is SAJJKYXRRVESDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO4/c19-15(12-8-4-5-9-13(12)17(20)21)16-18-10-14(22-16)11-6-2-1-3-7-11/h1-10H,(H,20,21).
What are the key properties of 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid?
2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid has a molecular weight of 293.28 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-phenyl-1,3-oxazole-2-carbonyl)benzoic acid is sourced from PubChem (CID 134122364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).