C10H6NNaO3 — CID 71755872
sodium 5-phenyl-1,3-oxazole-2-carboxylate (PubChem CID 71755872) has the molecular formula C10H6NNaO3 and a molecular weight of 211.15 g/mol. Its IUPAC name is sodium 5-phenyl-1,3-oxazole-2-carboxylate.
| Compound Name | sodium 5-phenyl-1,3-oxazole-2-carboxylate |
|---|---|
| PubChem CID | 71755872 |
| Molecular Formula | C10H6NNaO3 |
| Molecular Weight | 211.15 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | sodium 5-phenyl-1,3-oxazole-2-carboxylate |
| SMILES | O=C([O-])c1ncc(-c2ccccc2)o1.[Na+] |
| InChI | InChI=1S/C10H7NO3.Na/c12-10(13)9-11-6-8(14-9)7-4-2-1-3-5-7;/h1-6H,(H,12,13);/q;+1/p-1 |
| InChIKey | DJBVNWMORVQGEI-UHFFFAOYSA-M |
| XLogP | -2.29 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.15 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |