C9H7NO4S — CID 154638210
5-phenyl-1,3-oxazole-2-sulfonic acid (PubChem CID 154638210) has the molecular formula C9H7NO4S and a molecular weight of 225.23 g/mol. Its IUPAC name is 5-phenyl-1,3-oxazole-2-sulfonic acid.
| Compound Name | 5-phenyl-1,3-oxazole-2-sulfonic acid |
|---|---|
| PubChem CID | 154638210 |
| Molecular Formula | C9H7NO4S |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 5-phenyl-1,3-oxazole-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C9H7NO4S/c11-15(12,13)9-10-6-8(14-9)7-4-2-1-3-5-7/h1-6H,(H,11,12,13) |
| InChIKey | JTKWWTZEQRHWIR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|