C9H9NO4S — CID 175144268
benzene;1,3-oxazole-2-sulfonic acid (PubChem CID 175144268) has the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. Its IUPAC name is benzene;1,3-oxazole-2-sulfonic acid.
| Compound Name | benzene;1,3-oxazole-2-sulfonic acid |
|---|---|
| PubChem CID | 175144268 |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | benzene;1,3-oxazole-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ncco1.c1ccccc1 |
| InChI | InChI=1S/C6H6.C3H3NO4S/c1-2-4-6-5-3-1;5-9(6,7)3-4-1-2-8-3/h1-6H;1-2H,(H,5,6,7) |
| InChIKey | QCRNTBOEAAWMGL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|