About 2-pyridin-2-ylsulfonyl-1,3-oxazole
2-pyridin-2-ylsulfonyl-1,3-oxazole (PubChem CID 175524122) has the molecular formula C8H6N2O3S
and a molecular weight of 210.21 g/mol. Its IUPAC name is 2-pyridin-2-ylsulfonyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-pyridin-2-ylsulfonyl-1,3-oxazole |
| PubChem CID | 175524122 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-pyridin-2-ylsulfonyl-1,3-oxazole |
| SMILES | O=S(=O)(c1ccccn1)c1ncco1 |
| InChI | InChI=1S/C8H6N2O3S/c11-14(12,8-10-5-6-13-8)7-3-1-2-4-9-7/h1-6H |
| InChIKey | YBJBZFPXMUHIFB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyridin-2-ylsulfonyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylsulfonyl-1,3-oxazole?
The IUPAC name of 2-pyridin-2-ylsulfonyl-1,3-oxazole (CID 175524122) is 2-pyridin-2-ylsulfonyl-1,3-oxazole.
What is the SMILES notation for 2-pyridin-2-ylsulfonyl-1,3-oxazole?
The canonical SMILES for 2-pyridin-2-ylsulfonyl-1,3-oxazole is O=S(=O)(c1ccccn1)c1ncco1.
What is the InChIKey of 2-pyridin-2-ylsulfonyl-1,3-oxazole?
The InChIKey is YBJBZFPXMUHIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3S/c11-14(12,8-10-5-6-13-8)7-3-1-2-4-9-7/h1-6H.
What are the key properties of 2-pyridin-2-ylsulfonyl-1,3-oxazole?
2-pyridin-2-ylsulfonyl-1,3-oxazole has a molecular weight of 210.21 g/mol, XLogP of 0.90, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylsulfonyl-1,3-oxazole is sourced from PubChem (CID 175524122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).