C10H8FNO3S — CID 141303164
5-(3-fluorophenyl)-2-methylsulfonyl-1,3-oxazole (PubChem CID 141303164) has the molecular formula C10H8FNO3S and a molecular weight of 241.24 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-2-methylsulfonyl-1,3-oxazole.
| Compound Name | 5-(3-fluorophenyl)-2-methylsulfonyl-1,3-oxazole |
|---|---|
| PubChem CID | 141303164 |
| Molecular Formula | C10H8FNO3S |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 5-(3-fluorophenyl)-2-methylsulfonyl-1,3-oxazole |
| SMILES | CS(=O)(=O)c1ncc(-c2cccc(F)c2)o1 |
| InChI | InChI=1S/C10H8FNO3S/c1-16(13,14)10-12-6-9(15-10)7-3-2-4-8(11)5-7/h2-6H,1H3 |
| InChIKey | XXWORLNBQUUKFW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |