C16H12F2N2O — CID 158173955
N-(2,4-difluorophenyl)-5-(3-methylphenyl)-1,3-oxazol-2-amine (PubChem CID 158173955) has the molecular formula C16H12F2N2O and a molecular weight of 286.28 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-(3-methylphenyl)-1,3-oxazol-2-amine.
| Compound Name | N-(2,4-difluorophenyl)-5-(3-methylphenyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 158173955 |
| Molecular Formula | C16H12F2N2O |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-(3-methylphenyl)-1,3-oxazol-2-amine |
| SMILES | Cc1cccc(-c2cnc(Nc3ccc(F)cc3F)o2)c1 |
| InChI | InChI=1S/C16H12F2N2O/c1-10-3-2-4-11(7-10)15-9-19-16(21-15)20-14-6-5-12(17)8-13(14)18/h2-9H,1H3,(H,19,20) |
| InChIKey | STMUROBLZPRHBM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |