C16H11F3N2O — CID 141185425
5-phenyl-N-[2-(trifluoromethyl)phenyl]-1,3-oxazol-2-amine (PubChem CID 141185425) has the molecular formula C16H11F3N2O and a molecular weight of 304.27 g/mol. Its IUPAC name is 5-phenyl-N-[2-(trifluoromethyl)phenyl]-1,3-oxazol-2-amine.
| Compound Name | 5-phenyl-N-[2-(trifluoromethyl)phenyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 141185425 |
| Molecular Formula | C16H11F3N2O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 5-phenyl-N-[2-(trifluoromethyl)phenyl]-1,3-oxazol-2-amine |
| SMILES | FC(F)(F)c1ccccc1Nc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H11F3N2O/c17-16(18,19)12-8-4-5-9-13(12)21-15-20-10-14(22-15)11-6-2-1-3-7-11/h1-10H,(H,20,21) |
| InChIKey | UKZDYZMIGNHAFM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |