C11H6F3NO2 — CID 83389105
2,2,2-trifluoro-1-(5-phenyl-1,3-oxazol-2-yl)ethanone (PubChem CID 83389105) has the molecular formula C11H6F3NO2 and a molecular weight of 241.17 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(5-phenyl-1,3-oxazol-2-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(5-phenyl-1,3-oxazol-2-yl)ethanone |
|---|---|
| PubChem CID | 83389105 |
| Molecular Formula | C11H6F3NO2 |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 2,2,2-trifluoro-1-(5-phenyl-1,3-oxazol-2-yl)ethanone |
| SMILES | O=C(c1ncc(-c2ccccc2)o1)C(F)(F)F |
| InChI | InChI=1S/C11H6F3NO2/c12-11(13,14)9(16)10-15-6-8(17-10)7-4-2-1-3-5-7/h1-6H |
| InChIKey | QGLJNQDXLMCBRD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |