C16H13FN2O3 — CID 139441363
[3-[2-(3-fluoroanilino)-1,3-oxazol-5-yl]phenyl]methanediol (PubChem CID 139441363) has the molecular formula C16H13FN2O3 and a molecular weight of 300.29 g/mol. Its IUPAC name is [3-[2-(3-fluoroanilino)-1,3-oxazol-5-yl]phenyl]methanediol.
| Compound Name | [3-[2-(3-fluoroanilino)-1,3-oxazol-5-yl]phenyl]methanediol |
|---|---|
| PubChem CID | 139441363 |
| Molecular Formula | C16H13FN2O3 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | [3-[2-(3-fluoroanilino)-1,3-oxazol-5-yl]phenyl]methanediol |
| SMILES | OC(O)c1cccc(-c2cnc(Nc3cccc(F)c3)o2)c1 |
| InChI | InChI=1S/C16H13FN2O3/c17-12-5-2-6-13(8-12)19-16-18-9-14(22-16)10-3-1-4-11(7-10)15(20)21/h1-9,15,20-21H,(H,18,19) |
| InChIKey | UCXOCJHYSOOPHL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|