C15H12ClN3O — CID 146018038
3-N-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]benzene-1,3-diamine (PubChem CID 146018038) has the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. Its IUPAC name is 3-N-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]benzene-1,3-diamine.
| Compound Name | 3-N-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 146018038 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-N-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2ncc(-c3ccc(Cl)cc3)o2)c1 |
| InChI | InChI=1S/C15H12ClN3O/c16-11-6-4-10(5-7-11)14-9-18-15(20-14)19-13-3-1-2-12(17)8-13/h1-9H,17H2,(H,18,19) |
| InChIKey | RMRVZWMKRCLSFX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|