C14H11ClN6O2 — CID 155585459
5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyrazine-2-carboximidamide (PubChem CID 155585459) has the molecular formula C14H11ClN6O2 and a molecular weight of 330.74 g/mol. Its IUPAC name is 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyrazine-2-carboximidamide.
| Compound Name | 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 155585459 |
| Molecular Formula | C14H11ClN6O2 |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyrazine-2-carboximidamide |
| SMILES | NC(=NO)c1cnc(Nc2ncc(-c3ccc(Cl)cc3)o2)cn1 |
| InChI | InChI=1S/C14H11ClN6O2/c15-9-3-1-8(2-4-9)11-6-19-14(23-11)20-12-7-17-10(5-18-12)13(16)21-22/h1-7,22H,(H2,16,21)(H,18,19,20) |
| InChIKey | QHPFHYGMIVUCBB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|