C15H13N3O2 — CID 167652045
6-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]amino]pyridin-3-ol (PubChem CID 167652045) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 6-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]amino]pyridin-3-ol.
| Compound Name | 6-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]amino]pyridin-3-ol |
|---|---|
| PubChem CID | 167652045 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]amino]pyridin-3-ol |
| SMILES | Cc1ccc(-c2cnc(Nc3ccc(O)cn3)o2)cc1 |
| InChI | InChI=1S/C15H13N3O2/c1-10-2-4-11(5-3-10)13-9-17-15(20-13)18-14-7-6-12(19)8-16-14/h2-9,19H,1H3,(H,16,17,18) |
| InChIKey | WCZAOYMCQRYITL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |