C20H22ClN3O2 — CID 166108220
2-chloro-4-[2-(3,5-dimethylanilino)-1,3-oxazol-5-yl]benzamide;ethane (PubChem CID 166108220) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 2-chloro-4-[2-(3,5-dimethylanilino)-1,3-oxazol-5-yl]benzamide;ethane.
| Compound Name | 2-chloro-4-[2-(3,5-dimethylanilino)-1,3-oxazol-5-yl]benzamide;ethane |
|---|---|
| PubChem CID | 166108220 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-chloro-4-[2-(3,5-dimethylanilino)-1,3-oxazol-5-yl]benzamide;ethane |
| SMILES | CC.Cc1cc(C)cc(Nc2ncc(-c3ccc(C(N)=O)c(Cl)c3)o2)c1 |
| InChI | InChI=1S/C18H16ClN3O2.C2H6/c1-10-5-11(2)7-13(6-10)22-18-21-9-16(24-18)12-3-4-14(17(20)23)15(19)8-12;1-2/h3-9H,1-2H3,(H2,20,23)(H,21,22);1-2H3 |
| InChIKey | QBHXGJFXGJIFQX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |