About 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide
4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide (PubChem CID 11965524) has the molecular formula C19H17N3O3
and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide.
Molecular Properties
| Compound Name | 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide |
| PubChem CID | 11965524 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide |
| SMILES | CC(=O)c1ccc(C)c(Nc2ncc(-c3ccc(C(N)=O)cc3)o2)c1 |
| InChI | InChI=1S/C19H17N3O3/c1-11-3-4-15(12(2)23)9-16(11)22-19-21-10-17(25-19)13-5-7-14(8-6-13)18(20)24/h3-10H,1-2H3,(H2,20,24)(H,21,22) |
| InChIKey | AZAYRZCHFFAKMB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide?
The IUPAC name of 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide (CID 11965524) is 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide.
What is the SMILES notation for 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide?
The canonical SMILES for 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide is CC(=O)c1ccc(C)c(Nc2ncc(-c3ccc(C(N)=O)cc3)o2)c1.
What is the InChIKey of 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide?
The InChIKey is AZAYRZCHFFAKMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O3/c1-11-3-4-15(12(2)23)9-16(11)22-19-21-10-17(25-19)13-5-7-14(8-6-13)18(20)24/h3-10H,1-2H3,(H2,20,24)(H,21,22).
What are the key properties of 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide?
4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide has a molecular weight of 335.36 g/mol, XLogP of 3.70, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(5-acetyl-2-methylanilino)-1,3-oxazol-5-yl]benzamide is sourced from PubChem (CID 11965524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).