C23H20IN5O2 — CID 89327547
1-[4-(iodomethyl)phenyl]-3-[4-methyl-3-[(5-pyridin-3-yl-1,3-oxazol-2-yl)amino]phenyl]urea (PubChem CID 89327547) has the molecular formula C23H20IN5O2 and a molecular weight of 525.35 g/mol. Its IUPAC name is 1-[4-(iodomethyl)phenyl]-3-[4-methyl-3-[(5-pyridin-3-yl-1,3-oxazol-2-yl)amino]phenyl]urea.
| Compound Name | 1-[4-(iodomethyl)phenyl]-3-[4-methyl-3-[(5-pyridin-3-yl-1,3-oxazol-2-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 89327547 |
| Molecular Formula | C23H20IN5O2 |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 1-[4-(iodomethyl)phenyl]-3-[4-methyl-3-[(5-pyridin-3-yl-1,3-oxazol-2-yl)amino]phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(CI)cc2)cc1Nc1ncc(-c2cccnc2)o1 |
| InChI | InChI=1S/C23H20IN5O2/c1-15-4-7-19(28-22(30)27-18-8-5-16(12-24)6-9-18)11-20(15)29-23-26-14-21(31-23)17-3-2-10-25-13-17/h2-11,13-14H,12H2,1H3,(H,26,29)(H2,27,28,30) |
| InChIKey | ACWWBOOGEGQILF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|