C23H19ClN6O — CID 135393863
1-(4-chlorophenyl)-3-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]urea (PubChem CID 135393863) has the molecular formula C23H19ClN6O and a molecular weight of 430.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 135393863 |
| Molecular Formula | C23H19ClN6O |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(Cl)cc2)cc1Nc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C23H19ClN6O/c1-15-4-7-19(28-23(31)27-18-8-5-17(24)6-9-18)13-21(15)30-22-26-12-10-20(29-22)16-3-2-11-25-14-16/h2-14H,1H3,(H,26,29,30)(H2,27,28,31) |
| InChIKey | FBCMFKAMKGDNIP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |