C28H22N6OS — CID 71304469
N-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamothioyl]naphthalene-2-carboxamide (PubChem CID 71304469) has the molecular formula C28H22N6OS and a molecular weight of 490.59 g/mol. Its IUPAC name is N-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamothioyl]naphthalene-2-carboxamide.
| Compound Name | N-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamothioyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 71304469 |
| Molecular Formula | C28H22N6OS |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamothioyl]naphthalene-2-carboxamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)c2ccc3ccccc3c2)cc1Nc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C28H22N6OS/c1-18-8-11-23(16-25(18)33-27-30-14-12-24(32-27)22-7-4-13-29-17-22)31-28(36)34-26(35)21-10-9-19-5-2-3-6-20(19)15-21/h2-17H,1H3,(H,30,32,33)(H2,31,34,35,36) |
| InChIKey | DCNZUJLHMCLLLR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|