C17H14N2O4 — CID 166108179
4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid (PubChem CID 166108179) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid.
| Compound Name | 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 166108179 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid |
| SMILES | COc1cccc(Nc2ncc(-c3ccc(C(=O)O)cc3)o2)c1 |
| InChI | InChI=1S/C17H14N2O4/c1-22-14-4-2-3-13(9-14)19-17-18-10-15(23-17)11-5-7-12(8-6-11)16(20)21/h2-10H,1H3,(H,18,19)(H,20,21) |
| InChIKey | OVNZZGMJYUUJKN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |