4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid

C17H14N2O4 — CID 166108179

IUPAC4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid
SMILESCOc1cccc(Nc2ncc(-c3ccc(C(=O)O)cc3)o2)c1
InChIInChI=1S/C17H14N2O4/c1-22-14-4-2-3-13(9-14)19-17-18-10-15(23-17)11-5-7-12(8-6-11)16(20)21/h2-10H,1H3,(H,18,19)(H,20,21)
InChIKeyOVNZZGMJYUUJKN-UHFFFAOYSA-N
MW310.31 g/mol
LogP3.79
Rot. Bonds5

About 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid

4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid (PubChem CID 166108179) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid.

Molecular Properties

Compound Name4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid
PubChem CID166108179
Molecular FormulaC17H14N2O4
Molecular Weight310.31 g/mol
Exact Mass310.10
IUPAC Name4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid
SMILESCOc1cccc(Nc2ncc(-c3ccc(C(=O)O)cc3)o2)c1
InChIInChI=1S/C17H14N2O4/c1-22-14-4-2-3-13(9-14)19-17-18-10-15(23-17)11-5-7-12(8-6-11)16(20)21/h2-10H,1H3,(H,18,19)(H,20,21)
InChIKeyOVNZZGMJYUUJKN-UHFFFAOYSA-N
XLogP3.79
TPSA84.59 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.31
LogP ≤ 53.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid?
The IUPAC name of 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid (CID 166108179) is 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid.
What is the SMILES notation for 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid?
The canonical SMILES for 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid is COc1cccc(Nc2ncc(-c3ccc(C(=O)O)cc3)o2)c1.
What is the InChIKey of 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid?
The InChIKey is OVNZZGMJYUUJKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4/c1-22-14-4-2-3-13(9-14)19-17-18-10-15(23-17)11-5-7-12(8-6-11)16(20)21/h2-10H,1H3,(H,18,19)(H,20,21).
What are the key properties of 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid?
4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid has a molecular weight of 310.31 g/mol, XLogP of 3.79, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3-methoxyanilino)-1,3-oxazol-5-yl]benzoic acid is sourced from PubChem (CID 166108179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).