C17H12ClFN2O3 — CID 166108177
2-chloro-4-[2-(3-fluoro-5-methylanilino)-1,3-oxazol-5-yl]benzoic acid (PubChem CID 166108177) has the molecular formula C17H12ClFN2O3 and a molecular weight of 346.75 g/mol. Its IUPAC name is 2-chloro-4-[2-(3-fluoro-5-methylanilino)-1,3-oxazol-5-yl]benzoic acid.
| Compound Name | 2-chloro-4-[2-(3-fluoro-5-methylanilino)-1,3-oxazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 166108177 |
| Molecular Formula | C17H12ClFN2O3 |
| Molecular Weight | 346.75 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-chloro-4-[2-(3-fluoro-5-methylanilino)-1,3-oxazol-5-yl]benzoic acid |
| SMILES | Cc1cc(F)cc(Nc2ncc(-c3ccc(C(=O)O)c(Cl)c3)o2)c1 |
| InChI | InChI=1S/C17H12ClFN2O3/c1-9-4-11(19)7-12(5-9)21-17-20-8-15(24-17)10-2-3-13(16(22)23)14(18)6-10/h2-8H,1H3,(H,20,21)(H,22,23) |
| InChIKey | DCFINXGYVRCKPO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.75 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |