C13H10FN7O2 — CID 164936186
5-[[5-(5-fluoropyrazin-2-yl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 164936186) has the molecular formula C13H10FN7O2 and a molecular weight of 315.27 g/mol. Its IUPAC name is 5-[[5-(5-fluoropyrazin-2-yl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 5-[[5-(5-fluoropyrazin-2-yl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 164936186 |
| Molecular Formula | C13H10FN7O2 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 5-[[5-(5-fluoropyrazin-2-yl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1ccc(Nc2ncc(-c3cnc(F)cn3)o2)cn1 |
| InChI | InChI=1S/C13H10FN7O2/c14-11-6-17-9(4-18-11)10-5-19-13(23-10)20-7-1-2-8(16-3-7)12(15)21-22/h1-6,22H,(H2,15,21)(H,19,20) |
| InChIKey | KLLIHSLGGOVULZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|