C17H13ClN4O2 — CID 71612891
[5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazol-1-yl]methanol (PubChem CID 71612891) has the molecular formula C17H13ClN4O2 and a molecular weight of 340.77 g/mol. Its IUPAC name is [5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazol-1-yl]methanol.
| Compound Name | [5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazol-1-yl]methanol |
|---|---|
| PubChem CID | 71612891 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | [5-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]amino]indazol-1-yl]methanol |
| SMILES | OCn1ncc2cc(Nc3ncc(-c4ccc(Cl)cc4)o3)ccc21 |
| InChI | InChI=1S/C17H13ClN4O2/c18-13-3-1-11(2-4-13)16-9-19-17(24-16)21-14-5-6-15-12(7-14)8-20-22(15)10-23/h1-9,23H,10H2,(H,19,21) |
| InChIKey | NBIUYGQNQUNOLA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |