C16H16F3N7O3 — CID 155585292
ethane;N'-hydroxy-5-[[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]amino]pyrazine-2-carboximidamide (PubChem CID 155585292) has the molecular formula C16H16F3N7O3 and a molecular weight of 411.34 g/mol. Its IUPAC name is ethane;N'-hydroxy-5-[[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]amino]pyrazine-2-carboximidamide.
| Compound Name | ethane;N'-hydroxy-5-[[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]amino]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 155585292 |
| Molecular Formula | C16H16F3N7O3 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | ethane;N'-hydroxy-5-[[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]amino]pyrazine-2-carboximidamide |
| SMILES | CC.N/C(=N\O)c1cnc(Nc2nc(-c3ccc(OC(F)(F)F)cc3)no2)cn1 |
| InChI | InChI=1S/C14H10F3N7O3.C2H6/c15-14(16,17)26-8-3-1-7(2-4-8)12-22-13(27-24-12)21-10-6-19-9(5-20-10)11(18)23-25;1-2/h1-6,25H,(H2,18,23)(H,20,21,22,24);1-2H3 |
| InChIKey | XBISINUUMBOEMB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 144.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|