C10H7F3N4O3 — CID 2744635
3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-5-carbohydrazide (PubChem CID 2744635) has the molecular formula C10H7F3N4O3 and a molecular weight of 288.19 g/mol. Its IUPAC name is 3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-5-carbohydrazide.
| Compound Name | 3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2744635 |
| Molecular Formula | C10H7F3N4O3 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-5-carbohydrazide |
| SMILES | NNC(=O)c1nc(-c2ccc(OC(F)(F)F)cc2)no1 |
| InChI | InChI=1S/C10H7F3N4O3/c11-10(12,13)19-6-3-1-5(2-4-6)7-15-9(20-17-7)8(18)16-14/h1-4H,14H2,(H,16,18) |
| InChIKey | YRNKLMFDYOTVIN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|