C9H7BrN4O2 — CID 139220683
3-(4-bromophenyl)-1,2,4-oxadiazole-5-carbohydrazide (PubChem CID 139220683) has the molecular formula C9H7BrN4O2 and a molecular weight of 283.09 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1,2,4-oxadiazole-5-carbohydrazide.
| Compound Name | 3-(4-bromophenyl)-1,2,4-oxadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 139220683 |
| Molecular Formula | C9H7BrN4O2 |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 3-(4-bromophenyl)-1,2,4-oxadiazole-5-carbohydrazide |
| SMILES | NNC(=O)c1nc(-c2ccc(Br)cc2)no1 |
| InChI | InChI=1S/C9H7BrN4O2/c10-6-3-1-5(2-4-6)7-12-9(16-14-7)8(15)13-11/h1-4H,11H2,(H,13,15) |
| InChIKey | MTZWEIFUPAECGU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|