C20H16ClF3N4O3 — CID 122581643
6-chloro-N-[1-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]cyclopentyl]pyridine-3-carboxamide (PubChem CID 122581643) has the molecular formula C20H16ClF3N4O3 and a molecular weight of 452.82 g/mol. Its IUPAC name is 6-chloro-N-[1-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]cyclopentyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[1-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]cyclopentyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122581643 |
| Molecular Formula | C20H16ClF3N4O3 |
| Molecular Weight | 452.82 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 6-chloro-N-[1-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]cyclopentyl]pyridine-3-carboxamide |
| SMILES | O=C(NC1(c2nc(-c3ccc(OC(F)(F)F)cc3)no2)CCCC1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C20H16ClF3N4O3/c21-15-8-5-13(11-25-15)17(29)27-19(9-1-2-10-19)18-26-16(28-31-18)12-3-6-14(7-4-12)30-20(22,23)24/h3-8,11H,1-2,9-10H2,(H,27,29) |
| InChIKey | PVTMSODBSLANRD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.82 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|